Cost-effective and customizable 2-[(2-ethyl-3-benzofuranyl)methyl]-4,5-dihydro-1H-imidazolium chloride 37795-09-8 supplier
- Molecular Formula: C14H16 N2 O . Cl H
- Molecular Weight: 264.75058
- Boiling Point: °Cat760mmHg
- Flash Point: °C
- PSA： 37.53000
- Density: g/cm3
- LogP: 3.10580
2-[(2-ethyl-3-benzofuranyl)methyl]-4,5-dihydro-1H-imidazolium chloride(Cas 37795-09-8) Usage
|
General Description |
"2-[(2-ethyl-3-benzofuranyl)methyl]-4,5-dihydro-1H-imidazolium chloride" is a chemical compound that is a quaternary imidazolium salt. It is a type of ionic liquid, meaning it consists entirely of ions and has a low melting point. 2-[(2-ethyl-3-benzofuranyl)methyl]-4,5-dihydro-1H-imidazolium chloride is often used in organic synthesis and catalysis due to its unique properties, such as its ability to dissolve a wide range of organic and inorganic compounds. It is also used in pharmaceuticals and as a solvent in chemical processes. Additionally, it has antimicrobial properties and is being researched for potential applications in antimicrobial coatings and medical devices. |
InChI:InChI=1/C14H16N2O.ClH/c1-2-12-11(9-14-15-7-8-16-14)10-5-3-4-6-13(10)17-12;/h3-6H,2,7-9H2,1H3,(H,15,16);1H
